C18H25BrN2O3S — CID 56572001
[1-(4-bromophenyl)cyclobutyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone (PubChem CID 56572001) has the molecular formula C18H25BrN2O3S and a molecular weight of 429.38 g/mol. Its IUPAC name is [1-(4-bromophenyl)cyclobutyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone.
| Compound Name | [1-(4-bromophenyl)cyclobutyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56572001 |
| Molecular Formula | C18H25BrN2O3S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | [1-(4-bromophenyl)cyclobutyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)CCN1CCN(C(=O)C2(c3ccc(Br)cc3)CCC2)CC1 |
| InChI | InChI=1S/C18H25BrN2O3S/c1-25(23,24)14-13-20-9-11-21(12-10-20)17(22)18(7-2-8-18)15-3-5-16(19)6-4-15/h3-6H,2,7-14H2,1H3 |
| InChIKey | LAYCGTPUKIMJIY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |