C16H23BrN2O3S2 — CID 56572168
2-(4-bromophenyl)sulfanyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]propan-1-one (PubChem CID 56572168) has the molecular formula C16H23BrN2O3S2 and a molecular weight of 435.41 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(4-bromophenyl)sulfanyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 56572168 |
| Molecular Formula | C16H23BrN2O3S2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-1-[4-(2-methylsulfonylethyl)piperazin-1-yl]propan-1-one |
| SMILES | CC(Sc1ccc(Br)cc1)C(=O)N1CCN(CCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H23BrN2O3S2/c1-13(23-15-5-3-14(17)4-6-15)16(20)19-9-7-18(8-10-19)11-12-24(2,21)22/h3-6,13H,7-12H2,1-2H3 |
| InChIKey | LHNLJACPNPOOIB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |