C21H26N2O3S — CID 95753443
1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-2,2-diphenylethanone (PubChem CID 95753443) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 95753443 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[4-(2-methylsulfonylethyl)piperazin-1-yl]-2,2-diphenylethanone |
| SMILES | CS(=O)(=O)CCN1CCN(C(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O3S/c1-27(25,26)17-16-22-12-14-23(15-13-22)21(24)20(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20H,12-17H2,1H3 |
| InChIKey | HYHVTAHEEFQJAJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |