C14H16BrN3OS — CID 60667451
(4-bromo-1H-pyrrol-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 60667451) has the molecular formula C14H16BrN3OS and a molecular weight of 354.27 g/mol. Its IUPAC name is (4-bromo-1H-pyrrol-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (4-bromo-1H-pyrrol-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60667451 |
| Molecular Formula | C14H16BrN3OS |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (4-bromo-1H-pyrrol-2-yl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Br)c[nH]1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C14H16BrN3OS/c15-11-8-13(16-9-11)14(19)18-5-3-17(4-6-18)10-12-2-1-7-20-12/h1-2,7-9,16H,3-6,10H2 |
| InChIKey | JKMZPKIYTYNRMD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |