C32H25N3O5 — CID 56964882
(2'S,3R,7'R)-2',7'-bis(4-methoxyphenyl)-2,4'-dioxospiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile (PubChem CID 56964882) has the molecular formula C32H25N3O5 and a molecular weight of 531.57 g/mol. Its IUPAC name is (2'S,3R,7'R)-2',7'-bis(4-methoxyphenyl)-2,4'-dioxospiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile.
| Compound Name | (2'S,3R,7'R)-2',7'-bis(4-methoxyphenyl)-2,4'-dioxospiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile |
|---|---|
| PubChem CID | 56964882 |
| Molecular Formula | C32H25N3O5 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (2'S,3R,7'R)-2',7'-bis(4-methoxyphenyl)-2,4'-dioxospiro[1H-indole-3,5'-2,3,7,8-tetrahydrochromene]-6',6'-dicarbonitrile |
| SMILES | COc1ccc([C@@H]2CC(=O)C3=C(C[C@H](c4ccc(OC)cc4)C(C#N)(C#N)[C@@]34C(=O)Nc3ccccc34)O2)cc1 |
| InChI | InChI=1S/C32H25N3O5/c1-38-21-11-7-19(8-12-21)24-15-28-29(26(36)16-27(40-28)20-9-13-22(39-2)14-10-20)32(31(24,17-33)18-34)23-5-3-4-6-25(23)35-30(32)37/h3-14,24,27H,15-16H2,1-2H3,(H,35,37)/t24-,27+,32-/m1/s1 |
| InChIKey | AVEMBQGJKPRIRZ-YFCBNTRVSA-N |
| XLogP | 5.10 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |