C18H18N2O4 — CID 57380045
(3S)-3-[(1R)-1-hydroxy-2-oxopropyl]-3-(4-methoxyanilino)-1H-indol-2-one (PubChem CID 57380045) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (3S)-3-[(1R)-1-hydroxy-2-oxopropyl]-3-(4-methoxyanilino)-1H-indol-2-one.
| Compound Name | (3S)-3-[(1R)-1-hydroxy-2-oxopropyl]-3-(4-methoxyanilino)-1H-indol-2-one |
|---|---|
| PubChem CID | 57380045 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (3S)-3-[(1R)-1-hydroxy-2-oxopropyl]-3-(4-methoxyanilino)-1H-indol-2-one |
| SMILES | COc1ccc(N[C@@]2([C@@H](O)C(C)=O)C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-11(21)16(22)18(20-12-7-9-13(24-2)10-8-12)14-5-3-4-6-15(14)19-17(18)23/h3-10,16,20,22H,1-2H3,(H,19,23)/t16-,18-/m0/s1 |
| InChIKey | DLHKUERATIPLRH-WMZOPIPTSA-N |
| XLogP | 1.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|