C17H15N3O2S — CID 132546315
2'-(4-methoxyanilino)spiro[1H-indole-3,5'-4H-1,3-thiazole]-2-one (PubChem CID 132546315) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is 2'-(4-methoxyanilino)spiro[1H-indole-3,5'-4H-1,3-thiazole]-2-one.
| Compound Name | 2'-(4-methoxyanilino)spiro[1H-indole-3,5'-4H-1,3-thiazole]-2-one |
|---|---|
| PubChem CID | 132546315 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2'-(4-methoxyanilino)spiro[1H-indole-3,5'-4H-1,3-thiazole]-2-one |
| SMILES | COc1ccc(NC2=NCC3(S2)C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C17H15N3O2S/c1-22-12-8-6-11(7-9-12)19-16-18-10-17(23-16)13-4-2-3-5-14(13)20-15(17)21/h2-9H,10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | KBZFINKLHBNPTK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |