C31H27NO3 — CID 122375786
(3R)-3-[(E)-5-(4-methoxyphenyl)-5-oxopent-2-enyl]-3-(naphthalen-2-ylmethyl)-1H-indol-2-one (PubChem CID 122375786) has the molecular formula C31H27NO3 and a molecular weight of 461.56 g/mol. Its IUPAC name is (3R)-3-[(E)-5-(4-methoxyphenyl)-5-oxopent-2-enyl]-3-(naphthalen-2-ylmethyl)-1H-indol-2-one.
| Compound Name | (3R)-3-[(E)-5-(4-methoxyphenyl)-5-oxopent-2-enyl]-3-(naphthalen-2-ylmethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 122375786 |
| Molecular Formula | C31H27NO3 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (3R)-3-[(E)-5-(4-methoxyphenyl)-5-oxopent-2-enyl]-3-(naphthalen-2-ylmethyl)-1H-indol-2-one |
| SMILES | COc1ccc(C(=O)C/C=C/C[C@]2(Cc3ccc4ccccc4c3)C(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C31H27NO3/c1-35-26-17-15-24(16-18-26)29(33)12-6-7-19-31(27-10-4-5-11-28(27)32-30(31)34)21-22-13-14-23-8-2-3-9-25(23)20-22/h2-11,13-18,20H,12,19,21H2,1H3,(H,32,34)/b7-6+/t31-/m1/s1 |
| InChIKey | WQQJYQBLAXIUQO-FLGLVYIJSA-N |
| XLogP | 6.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|