C14H12O3S — CID 13352399
5-(4-methoxyphenyl)-5,6-dihydrothieno[3,2-b]pyran-7-one (PubChem CID 13352399) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-5,6-dihydrothieno[3,2-b]pyran-7-one.
| Compound Name | 5-(4-methoxyphenyl)-5,6-dihydrothieno[3,2-b]pyran-7-one |
|---|---|
| PubChem CID | 13352399 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-(4-methoxyphenyl)-5,6-dihydrothieno[3,2-b]pyran-7-one |
| SMILES | COc1ccc(C2CC(=O)c3sccc3O2)cc1 |
| InChI | InChI=1S/C14H12O3S/c1-16-10-4-2-9(3-5-10)13-8-11(15)14-12(17-13)6-7-18-14/h2-7,13H,8H2,1H3 |
| InChIKey | KDYIHNSBAQZZBB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |