C20H15N5O — CID 11859182
(1'S,3S,4'aR)-2'-imino-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydro-1H-naphthalene]-1',3',3'-tricarbonitrile (PubChem CID 11859182) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is (1'S,3S,4'aR)-2'-imino-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydro-1H-naphthalene]-1',3',3'-tricarbonitrile.
| Compound Name | (1'S,3S,4'aR)-2'-imino-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydro-1H-naphthalene]-1',3',3'-tricarbonitrile |
|---|---|
| PubChem CID | 11859182 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (1'S,3S,4'aR)-2'-imino-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydro-1H-naphthalene]-1',3',3'-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCCC[C@H]2[C@@]2(C(=O)Nc3ccccc32)C1(C#N)C#N |
| InChI | InChI=1S/C20H15N5O/c21-9-13-12-5-1-2-6-14(12)20(19(10-22,11-23)17(13)24)15-7-3-4-8-16(15)25-18(20)26/h3-5,7-8,13-14,24H,1-2,6H2,(H,25,26)/b24-17+/t13-,14+,20+/m0/s1 |
| InChIKey | BMLVOYDODUZWDA-YBQXXWATSA-N |
| XLogP | 2.81 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|