C21H17N5O — CID 3762349
2'-amino-6'-methyl-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydronaphthalene]-1',3',3'-tricarbonitrile (PubChem CID 3762349) has the molecular formula C21H17N5O and a molecular weight of 355.40 g/mol. Its IUPAC name is 2'-amino-6'-methyl-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydronaphthalene]-1',3',3'-tricarbonitrile.
| Compound Name | 2'-amino-6'-methyl-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydronaphthalene]-1',3',3'-tricarbonitrile |
|---|---|
| PubChem CID | 3762349 |
| Molecular Formula | C21H17N5O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2'-amino-6'-methyl-2-oxospiro[1H-indole-3,4'-4a,5,6,7-tetrahydronaphthalene]-1',3',3'-tricarbonitrile |
| SMILES | CC1CC=C2C(C#N)=C(N)C(C#N)(C#N)C3(C(=O)Nc4ccccc43)C2C1 |
| InChI | InChI=1S/C21H17N5O/c1-12-6-7-13-14(9-22)18(25)20(10-23,11-24)21(16(13)8-12)15-4-2-3-5-17(15)26-19(21)27/h2-5,7,12,16H,6,8,25H2,1H3,(H,26,27) |
| InChIKey | SLCAPPSOGCMOQX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|