C27H20ClN5O — CID 3646059
2-amino-1'-[(4-chlorophenyl)methyl]-2'-oxospiro[4a,5,6,7-tetrahydronaphthalene-4,3'-indole]-1,3,3-tricarbonitrile (PubChem CID 3646059) has the molecular formula C27H20ClN5O and a molecular weight of 465.94 g/mol. Its IUPAC name is 2-amino-1'-[(4-chlorophenyl)methyl]-2'-oxospiro[4a,5,6,7-tetrahydronaphthalene-4,3'-indole]-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-1'-[(4-chlorophenyl)methyl]-2'-oxospiro[4a,5,6,7-tetrahydronaphthalene-4,3'-indole]-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 3646059 |
| Molecular Formula | C27H20ClN5O |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-amino-1'-[(4-chlorophenyl)methyl]-2'-oxospiro[4a,5,6,7-tetrahydronaphthalene-4,3'-indole]-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C2(C(=O)N(Cc3ccc(Cl)cc3)c3ccccc32)C2CCCC=C12 |
| InChI | InChI=1S/C27H20ClN5O/c28-18-11-9-17(10-12-18)14-33-23-8-4-3-7-22(23)27(25(33)34)21-6-2-1-5-19(21)20(13-29)24(32)26(27,15-30)16-31/h3-5,7-12,21H,1-2,6,14,32H2 |
| InChIKey | SSIPYSVUQFZIQN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|