C34H30ClN3O2 — CID 102130172
3-amino-1'-benzyl-1-(4-chlorobenzoyl)-5'-methyl-2'-oxospiro[1,6,7,8,9,9a-hexahydrobenzo[7]annulene-2,3'-indole]-4-carbonitrile (PubChem CID 102130172) has the molecular formula C34H30ClN3O2 and a molecular weight of 548.09 g/mol. Its IUPAC name is 3-amino-1'-benzyl-1-(4-chlorobenzoyl)-5'-methyl-2'-oxospiro[1,6,7,8,9,9a-hexahydrobenzo[7]annulene-2,3'-indole]-4-carbonitrile.
| Compound Name | 3-amino-1'-benzyl-1-(4-chlorobenzoyl)-5'-methyl-2'-oxospiro[1,6,7,8,9,9a-hexahydrobenzo[7]annulene-2,3'-indole]-4-carbonitrile |
|---|---|
| PubChem CID | 102130172 |
| Molecular Formula | C34H30ClN3O2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 3-amino-1'-benzyl-1-(4-chlorobenzoyl)-5'-methyl-2'-oxospiro[1,6,7,8,9,9a-hexahydrobenzo[7]annulene-2,3'-indole]-4-carbonitrile |
| SMILES | Cc1ccc2c(c1)C1(C(=O)N2Cc2ccccc2)C(N)=C(C#N)C2=CCCCCC2C1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H30ClN3O2/c1-21-12-17-29-28(18-21)34(33(40)38(29)20-22-8-4-2-5-9-22)30(31(39)23-13-15-24(35)16-14-23)26-11-7-3-6-10-25(26)27(19-36)32(34)37/h2,4-5,8-10,12-18,26,30H,3,6-7,11,20,37H2,1H3 |
| InChIKey | MTWVATRHJIRYCZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |