C20H17N6O+ — CID 7103481
(3R,8'aR)-6'-imino-2'-methyl-2-oxospiro[1H-indole-3,8'-2,3,5,8a-tetrahydro-1H-isoquinolin-2-ium]-5',7',7'-tricarbonitrile (PubChem CID 7103481) has the molecular formula C20H17N6O+ and a molecular weight of 357.40 g/mol. Its IUPAC name is (3R,8'aR)-6'-imino-2'-methyl-2-oxospiro[1H-indole-3,8'-2,3,5,8a-tetrahydro-1H-isoquinolin-2-ium]-5',7',7'-tricarbonitrile.
| Compound Name | (3R,8'aR)-6'-imino-2'-methyl-2-oxospiro[1H-indole-3,8'-2,3,5,8a-tetrahydro-1H-isoquinolin-2-ium]-5',7',7'-tricarbonitrile |
|---|---|
| PubChem CID | 7103481 |
| Molecular Formula | C20H17N6O+ |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (3R,8'aR)-6'-imino-2'-methyl-2-oxospiro[1H-indole-3,8'-2,3,5,8a-tetrahydro-1H-isoquinolin-2-ium]-5',7',7'-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=CC[NH+](C)C[C@H]2[C@]2(C(=O)Nc3ccccc32)C1(C#N)C#N |
| InChI | InChI=1S/C20H16N6O/c1-26-7-6-12-13(8-21)17(24)19(10-22,11-23)20(15(12)9-26)14-4-2-3-5-16(14)25-18(20)27/h2-6,13,15,24H,7,9H2,1H3,(H,25,27)/p+1/b24-17+/t13?,15-,20-/m1/s1 |
| InChIKey | FPKDXFHXYXRRGM-HKVYUBCFSA-O |
| XLogP | 0.15 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|