C14H7N5O2 — CID 146680270
2'-imino-2,4'-dioxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hexane]-1',5'-dicarbonitrile (PubChem CID 146680270) has the molecular formula C14H7N5O2 and a molecular weight of 277.24 g/mol. Its IUPAC name is 2'-imino-2,4'-dioxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hexane]-1',5'-dicarbonitrile.
| Compound Name | 2'-imino-2,4'-dioxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hexane]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 146680270 |
| Molecular Formula | C14H7N5O2 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 2'-imino-2,4'-dioxospiro[1H-indole-3,6'-3-azabicyclo[3.1.0]hexane]-1',5'-dicarbonitrile |
| SMILES | [H]/N=C1\NC(=O)C2(C#N)C1(C#N)C21C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C14H7N5O2/c15-5-12-9(17)19-10(20)13(12,6-16)14(12)7-3-1-2-4-8(7)18-11(14)21/h1-4H,(H,18,21)(H2,17,19,20) |
| InChIKey | XLIUPTTVIFPTHW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 129.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|