C29H21N5O3 — CID 71567013
CID 71567013 (PubChem CID 71567013) has the molecular formula C29H21N5O3 and a molecular weight of 487.52 g/mol.
| Compound Name | CID 71567013 |
|---|---|
| PubChem CID | 71567013 |
| Molecular Formula | C29H21N5O3 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | — |
| SMILES | CN1C[C@](C#N)(C(=O)c2c[nH]c3ccccc23)[C@]2(C(=O)Nc3ccccc32)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C29H21N5O3/c1-34-16-27(15-30,24(35)18-14-31-21-11-5-2-8-17(18)21)28(19-9-3-6-12-22(19)32-25(28)36)29(34)20-10-4-7-13-23(20)33-26(29)37/h2-14,31H,16H2,1H3,(H,32,36)(H,33,37)/t27-,28+,29-/m1/s1 |
| InChIKey | VRKYHXJZALFLGH-SSBOKUKZSA-N |
| XLogP | 3.54 |
| TPSA | 118.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |