C38H30N6O2 — CID 118724218
(3R,3'R,4'R)-4'-(1,3-diphenylpyrazol-4-yl)-3'-(1H-indole-3-carbonyl)-1,1'-dimethyl-2-oxospiro[indole-3,5'-pyrrolidine]-3'-carbonitrile (PubChem CID 118724218) has the molecular formula C38H30N6O2 and a molecular weight of 602.70 g/mol. Its IUPAC name is (3R,3'R,4'R)-4'-(1,3-diphenylpyrazol-4-yl)-3'-(1H-indole-3-carbonyl)-1,1'-dimethyl-2-oxospiro[indole-3,5'-pyrrolidine]-3'-carbonitrile.
| Compound Name | (3R,3'R,4'R)-4'-(1,3-diphenylpyrazol-4-yl)-3'-(1H-indole-3-carbonyl)-1,1'-dimethyl-2-oxospiro[indole-3,5'-pyrrolidine]-3'-carbonitrile |
|---|---|
| PubChem CID | 118724218 |
| Molecular Formula | C38H30N6O2 |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.24 |
| IUPAC Name | (3R,3'R,4'R)-4'-(1,3-diphenylpyrazol-4-yl)-3'-(1H-indole-3-carbonyl)-1,1'-dimethyl-2-oxospiro[indole-3,5'-pyrrolidine]-3'-carbonitrile |
| SMILES | CN1C(=O)[C@]2(c3ccccc31)[C@H](c1cn(-c3ccccc3)nc1-c1ccccc1)[C@@](C#N)(C(=O)c1c[nH]c3ccccc13)CN2C |
| InChI | InChI=1S/C38H30N6O2/c1-42-24-37(23-39,35(45)28-21-40-31-19-11-9-17-27(28)31)34(38(42)30-18-10-12-20-32(30)43(2)36(38)46)29-22-44(26-15-7-4-8-16-26)41-33(29)25-13-5-3-6-14-25/h3-22,34,40H,24H2,1-2H3/t34-,37+,38+/m1/s1 |
| InChIKey | GSDZVXLFBVQLDA-FTMYYPKXSA-N |
| XLogP | 6.31 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |