C31H28FeN4O2+2 — CID 44519779
CID 44519779 (PubChem CID 44519779) has the molecular formula C31H28FeN4O2+2 and a molecular weight of 544.44 g/mol.
| Compound Name | CID 44519779 |
|---|---|
| PubChem CID | 44519779 |
| Molecular Formula | C31H28FeN4O2+2 |
| Molecular Weight | 544.44 g/mol |
| Exact Mass | 544.16 |
| IUPAC Name | — |
| SMILES | O=C(O)[C@H](Cc1c[nH]c2ccccc12)NCc1cn(-c2ccccc2)nc1[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C26H23N4O2.C5H5.Fe/c31-26(32)24(14-19-15-27-23-13-7-6-12-22(19)23)28-16-20-17-30(21-10-2-1-3-11-21)29-25(20)18-8-4-5-9-18;1-2-4-5-3-1;/h1-13,15,17,24,27-28H,14,16H2,(H,31,32);1-5H;/q;;+2/t24-;;/m0../s1 |
| InChIKey | XTRCVTHPVAKMRI-ASMAMLKCSA-N |
| XLogP | 4.91 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|