C21H21N3O2 — CID 124815638
(2S)-3-(1H-indol-3-yl)-2-[(1-methylindol-3-yl)methylamino]propanoic acid (PubChem CID 124815638) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-[(1-methylindol-3-yl)methylamino]propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-[(1-methylindol-3-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 124815638 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-[(1-methylindol-3-yl)methylamino]propanoic acid |
| SMILES | Cn1cc(CN[C@@H](Cc2c[nH]c3ccccc23)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C21H21N3O2/c1-24-13-15(17-7-3-5-9-20(17)24)12-23-19(21(25)26)10-14-11-22-18-8-4-2-6-16(14)18/h2-9,11,13,19,22-23H,10,12H2,1H3,(H,25,26)/t19-/m0/s1 |
| InChIKey | FZUXGFDPLIXPCE-IBGZPJMESA-N |
| XLogP | 3.45 |
| TPSA | 70.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |