C28H20N4O — CID 4257613
3-(1,3-diphenylpyrazol-4-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile (PubChem CID 4257613) has the molecular formula C28H20N4O and a molecular weight of 428.50 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4257613 |
| Molecular Formula | C28H20N4O |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(C#N)=Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H20N4O/c1-19-26(24-14-8-9-15-25(24)30-19)28(33)21(17-29)16-22-18-32(23-12-6-3-7-13-23)31-27(22)20-10-4-2-5-11-20/h2-16,18,30H,1H3 |
| InChIKey | ZQRDBFPRZBBSCK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|