C23H16N2O — CID 7912469
(E)-2-(2-methyl-1H-indole-3-carbonyl)-3-naphthalen-2-ylprop-2-enenitrile (PubChem CID 7912469) has the molecular formula C23H16N2O and a molecular weight of 336.39 g/mol. Its IUPAC name is (E)-2-(2-methyl-1H-indole-3-carbonyl)-3-naphthalen-2-ylprop-2-enenitrile.
| Compound Name | (E)-2-(2-methyl-1H-indole-3-carbonyl)-3-naphthalen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 7912469 |
| Molecular Formula | C23H16N2O |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (E)-2-(2-methyl-1H-indole-3-carbonyl)-3-naphthalen-2-ylprop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)/C(C#N)=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H16N2O/c1-15-22(20-8-4-5-9-21(20)25-15)23(26)19(14-24)13-16-10-11-17-6-2-3-7-18(17)12-16/h2-13,25H,1H3/b19-13+ |
| InChIKey | VMUOAERZKZVKRG-CPNJWEJPSA-N |
| XLogP | 5.42 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|