C22H17ClN2O3 — CID 9365656
(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile (PubChem CID 9365656) has the molecular formula C22H17ClN2O3 and a molecular weight of 392.84 g/mol. Its IUPAC name is (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9365656 |
| Molecular Formula | C22H17ClN2O3 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)/C(C#N)=C/c1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C22H17ClN2O3/c1-13-20(16-5-2-3-6-18(16)25-13)21(26)15(12-24)9-14-10-17(23)22-19(11-14)27-7-4-8-28-22/h2-3,5-6,9-11,25H,4,7-8H2,1H3/b15-9+ |
| InChIKey | SBQISMZCCLCQIC-OQLLNIDSSA-N |
| XLogP | 5.08 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|