C29H25N3O4 — CID 6305184
(E)-3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile (PubChem CID 6305184) has the molecular formula C29H25N3O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is (E)-3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6305184 |
| Molecular Formula | C29H25N3O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | (E)-3-[4-(4-tert-butylphenoxy)-3-nitrophenyl]-2-(2-methyl-1H-indole-3-carbonyl)prop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)/C(C#N)=C/c1ccc(Oc2ccc(C(C)(C)C)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H25N3O4/c1-18-27(23-7-5-6-8-24(23)31-18)28(33)20(17-30)15-19-9-14-26(25(16-19)32(34)35)36-22-12-10-21(11-13-22)29(2,3)4/h5-16,31H,1-4H3/b20-15+ |
| InChIKey | PXIPRDQVLOCEOQ-HMMYKYKNSA-N |
| XLogP | 7.26 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|