C21H14N4O — CID 9365660
(E)-2-(2-methyl-1H-indole-3-carbonyl)-3-quinoxalin-2-ylprop-2-enenitrile (PubChem CID 9365660) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is (E)-2-(2-methyl-1H-indole-3-carbonyl)-3-quinoxalin-2-ylprop-2-enenitrile.
| Compound Name | (E)-2-(2-methyl-1H-indole-3-carbonyl)-3-quinoxalin-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 9365660 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (E)-2-(2-methyl-1H-indole-3-carbonyl)-3-quinoxalin-2-ylprop-2-enenitrile |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)/C(C#N)=C/c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H14N4O/c1-13-20(16-6-2-3-7-17(16)24-13)21(26)14(11-22)10-15-12-23-18-8-4-5-9-19(18)25-15/h2-10,12,24H,1H3/b14-10+ |
| InChIKey | XONFXKPFIFOYJM-GXDHUFHOSA-N |
| XLogP | 4.21 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|