C15H9N3O4 — CID 139214645
2'-imino-2,5'-dioxospiro[1H-indole-3,4'-3,7-dihydrofuro[3,4-b]pyran]-3'-carbonitrile (PubChem CID 139214645) has the molecular formula C15H9N3O4 and a molecular weight of 295.25 g/mol. Its IUPAC name is 2'-imino-2,5'-dioxospiro[1H-indole-3,4'-3,7-dihydrofuro[3,4-b]pyran]-3'-carbonitrile.
| Compound Name | 2'-imino-2,5'-dioxospiro[1H-indole-3,4'-3,7-dihydrofuro[3,4-b]pyran]-3'-carbonitrile |
|---|---|
| PubChem CID | 139214645 |
| Molecular Formula | C15H9N3O4 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2'-imino-2,5'-dioxospiro[1H-indole-3,4'-3,7-dihydrofuro[3,4-b]pyran]-3'-carbonitrile |
| SMILES | [H]/N=C1\OC2=C(C(=O)OC2)C2(C(=O)Nc3ccccc32)C1C#N |
| InChI | InChI=1S/C15H9N3O4/c16-5-8-12(17)22-10-6-21-13(19)11(10)15(8)7-3-1-2-4-9(7)18-14(15)20/h1-4,8,17H,6H2,(H,18,20)/b17-12- |
| InChIKey | VCJRUWAJZFUOHM-ATVHPVEESA-N |
| XLogP | 0.83 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|