C19H16N6O4 — CID 137266944
2'-morpholin-4-yl-2,4',7'-trioxospiro[1H-indole-3,5'-6,8-dihydro-4aH-pyrido[2,3-d]pyrimidine]-6'-carbonitrile (PubChem CID 137266944) has the molecular formula C19H16N6O4 and a molecular weight of 392.38 g/mol. Its IUPAC name is 2'-morpholin-4-yl-2,4',7'-trioxospiro[1H-indole-3,5'-6,8-dihydro-4aH-pyrido[2,3-d]pyrimidine]-6'-carbonitrile.
| Compound Name | 2'-morpholin-4-yl-2,4',7'-trioxospiro[1H-indole-3,5'-6,8-dihydro-4aH-pyrido[2,3-d]pyrimidine]-6'-carbonitrile |
|---|---|
| PubChem CID | 137266944 |
| Molecular Formula | C19H16N6O4 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2'-morpholin-4-yl-2,4',7'-trioxospiro[1H-indole-3,5'-6,8-dihydro-4aH-pyrido[2,3-d]pyrimidine]-6'-carbonitrile |
| SMILES | N#CC1C(=O)NC2=NC(N3CCOCC3)=NC(=O)C2C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C19H16N6O4/c20-9-11-15(26)22-14-13(16(27)24-18(23-14)25-5-7-29-8-6-25)19(11)10-3-1-2-4-12(10)21-17(19)28/h1-4,11,13H,5-8H2,(H,21,28)(H,22,23,24,26,27) |
| InChIKey | IJXOEZYVYDDFBR-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 136.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |