C19H19N3O2 — CID 90901453
3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90901453) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90901453 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1/C=N/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H19N3O2/c23-19-17(16-3-1-2-4-18(16)21-19)13-20-14-5-7-15(8-6-14)22-9-11-24-12-10-22/h1-8,13,17H,9-12H2,(H,21,23)/b20-13+ |
| InChIKey | BTLVVXQENCPJHS-DEDYPNTBSA-N |
| XLogP | 2.96 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|