C19H18ClN3O2 — CID 91223892
5-chloro-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91223892) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 5-chloro-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91223892 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 5-chloro-3-[(4-morpholin-4-ylphenyl)iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1/C=N/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H18ClN3O2/c20-13-1-6-18-16(11-13)17(19(24)22-18)12-21-14-2-4-15(5-3-14)23-7-9-25-10-8-23/h1-6,11-12,17H,7-10H2,(H,22,24)/b21-12+ |
| InChIKey | PBBIVQSIIYNNLR-CIAFOILYSA-N |
| XLogP | 3.61 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|