C23H18FN3O — CID 91430072
3-[[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91430072) has the molecular formula C23H18FN3O and a molecular weight of 371.42 g/mol. Its IUPAC name is 3-[[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91430072 |
| Molecular Formula | C23H18FN3O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 3-[[4-(1,3-dihydroisoindol-2-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1/C=N/c1ccc(N2Cc3ccccc3C2)c(F)c1 |
| InChI | InChI=1S/C23H18FN3O/c24-20-11-17(25-12-19-18-7-3-4-8-21(18)26-23(19)28)9-10-22(20)27-13-15-5-1-2-6-16(15)14-27/h1-12,19H,13-14H2,(H,26,28)/b25-12+ |
| InChIKey | UKESVNWJPZZUET-BRJLIKDPSA-N |
| XLogP | 4.78 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|