C23H20F2N6O — CID 91475690
4-fluoro-3-[[3-fluoro-4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91475690) has the molecular formula C23H20F2N6O and a molecular weight of 434.45 g/mol. Its IUPAC name is 4-fluoro-3-[[3-fluoro-4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-fluoro-3-[[3-fluoro-4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91475690 |
| Molecular Formula | C23H20F2N6O |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-fluoro-3-[[3-fluoro-4-(4-pyrimidin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cccc(F)c2C1/C=N/c1ccc(N2CCN(c3ncccn3)CC2)c(F)c1 |
| InChI | InChI=1S/C23H20F2N6O/c24-17-3-1-4-19-21(17)16(22(32)29-19)14-28-15-5-6-20(18(25)13-15)30-9-11-31(12-10-30)23-26-7-2-8-27-23/h1-8,13-14,16H,9-12H2,(H,29,32)/b28-14+ |
| InChIKey | FBVRIFNPWTWYEG-CCVNUDIWSA-N |
| XLogP | 3.52 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|