C24H23FN6O — CID 91469809
6-fluoro-3-[[3-methyl-4-(4-pyrazin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91469809) has the molecular formula C24H23FN6O and a molecular weight of 430.49 g/mol. Its IUPAC name is 6-fluoro-3-[[3-methyl-4-(4-pyrazin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-[[3-methyl-4-(4-pyrazin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91469809 |
| Molecular Formula | C24H23FN6O |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 6-fluoro-3-[[3-methyl-4-(4-pyrazin-2-ylpiperazin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3cc(F)ccc32)ccc1N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C24H23FN6O/c1-16-12-18(28-14-20-19-4-2-17(25)13-21(19)29-24(20)32)3-5-22(16)30-8-10-31(11-9-30)23-15-26-6-7-27-23/h2-7,12-15,20H,8-11H2,1H3,(H,29,32)/b28-14+ |
| InChIKey | NMVAGZDGKWGMRK-CCVNUDIWSA-N |
| XLogP | 3.69 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|