C22H18F2N4O — CID 91411132
6-fluoro-3-[[3-fluoro-4-(2-pyridin-3-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91411132) has the molecular formula C22H18F2N4O and a molecular weight of 392.41 g/mol. Its IUPAC name is 6-fluoro-3-[[3-fluoro-4-(2-pyridin-3-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-[[3-fluoro-4-(2-pyridin-3-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91411132 |
| Molecular Formula | C22H18F2N4O |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 6-fluoro-3-[[3-fluoro-4-(2-pyridin-3-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1/C=N/c1ccc(NCCc2cccnc2)c(F)c1 |
| InChI | InChI=1S/C22H18F2N4O/c23-15-3-5-17-18(22(29)28-21(17)10-15)13-27-16-4-6-20(19(24)11-16)26-9-7-14-2-1-8-25-12-14/h1-6,8,10-13,18,26H,7,9H2,(H,28,29)/b27-13+ |
| InChIKey | PWRMFMJWBKZWBR-UVHMKAGCSA-N |
| XLogP | 4.45 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|