C21H23F2N3O — CID 91343024
3-[[4-[butyl(ethyl)amino]-3-fluorophenyl]iminomethyl]-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 91343024) has the molecular formula C21H23F2N3O and a molecular weight of 371.43 g/mol. Its IUPAC name is 3-[[4-[butyl(ethyl)amino]-3-fluorophenyl]iminomethyl]-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[butyl(ethyl)amino]-3-fluorophenyl]iminomethyl]-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91343024 |
| Molecular Formula | C21H23F2N3O |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-[[4-[butyl(ethyl)amino]-3-fluorophenyl]iminomethyl]-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | CCCCN(CC)c1ccc(/N=C/C2C(=O)Nc3ccc(F)cc32)cc1F |
| InChI | InChI=1S/C21H23F2N3O/c1-3-5-10-26(4-2)20-9-7-15(12-18(20)23)24-13-17-16-11-14(22)6-8-19(16)25-21(17)27/h6-9,11-13,17H,3-5,10H2,1-2H3,(H,25,27)/b24-13+ |
| InChIKey | FGLJEXHQSZYCKS-ZMOGYAJESA-N |
| XLogP | 5.03 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|