C20H22F2N4O — CID 91402105
3-[[4-[1-(dimethylamino)propan-2-ylamino]-3-fluorophenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 91402105) has the molecular formula C20H22F2N4O and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-[[4-[1-(dimethylamino)propan-2-ylamino]-3-fluorophenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[1-(dimethylamino)propan-2-ylamino]-3-fluorophenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91402105 |
| Molecular Formula | C20H22F2N4O |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-[[4-[1-(dimethylamino)propan-2-ylamino]-3-fluorophenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | CC(CN(C)C)Nc1ccc(/N=C/C2C(=O)Nc3cc(F)ccc32)cc1F |
| InChI | InChI=1S/C20H22F2N4O/c1-12(11-26(2)3)24-18-7-5-14(9-17(18)22)23-10-16-15-6-4-13(21)8-19(15)25-20(16)27/h4-10,12,16,24H,11H2,1-3H3,(H,25,27)/b23-10+ |
| InChIKey | CUKIEGBLEDEGSD-AUEPDCJTSA-N |
| XLogP | 3.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|