C20H19F2N3O2 — CID 90960094
6-fluoro-3-[[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90960094) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 6-fluoro-3-[[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-[[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90960094 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 6-fluoro-3-[[3-fluoro-4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1/C=N/c1ccc(NCC2CCCO2)c(F)c1 |
| InChI | InChI=1S/C20H19F2N3O2/c21-12-3-5-15-16(20(26)25-19(15)8-12)11-23-13-4-6-18(17(22)9-13)24-10-14-2-1-7-27-14/h3-6,8-9,11,14,16,24H,1-2,7,10H2,(H,25,26)/b23-11+ |
| InChIKey | RYGYFKUYOGAYLC-FOKLQQMPSA-N |
| XLogP | 3.99 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|