C20H20FN3O2 — CID 91504086
5-fluoro-3-[[4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91504086) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 5-fluoro-3-[[4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-[[4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91504086 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 5-fluoro-3-[[4-(oxolan-2-ylmethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1/C=N/c1ccc(NCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H20FN3O2/c21-13-3-8-19-17(10-13)18(20(25)24-19)12-23-15-6-4-14(5-7-15)22-11-16-2-1-9-26-16/h3-8,10,12,16,18,22H,1-2,9,11H2,(H,24,25)/b23-12+ |
| InChIKey | XUGIRBNNXJKSSE-FSJBWODESA-N |
| XLogP | 3.85 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|