C23H26FN3O2 — CID 90873924
6-fluoro-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90873924) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 6-fluoro-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 6-fluoro-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90873924 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 6-fluoro-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1/C=N/c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C23H26FN3O2/c24-17-5-10-20-21(23(28)26-22(20)15-17)16-25-18-6-8-19(9-7-18)29-14-4-13-27-11-2-1-3-12-27/h5-10,15-16,21H,1-4,11-14H2,(H,26,28)/b25-16+ |
| InChIKey | GJZGADQCRMFOCS-PCLIKHOPSA-N |
| XLogP | 4.52 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|