C24H26FN5O2 — CID 90800827
3-[[5-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1H-pyrazol-3-yl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 90800827) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 3-[[5-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1H-pyrazol-3-yl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[5-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1H-pyrazol-3-yl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90800827 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 3-[[5-[[4-[3-(dimethylamino)propoxy]phenyl]methyl]-1H-pyrazol-3-yl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | CN(C)CCCOc1ccc(Cc2cc(/N=C/C3C(=O)Nc4cc(F)ccc43)n[nH]2)cc1 |
| InChI | InChI=1S/C24H26FN5O2/c1-30(2)10-3-11-32-19-7-4-16(5-8-19)12-18-14-23(29-28-18)26-15-21-20-9-6-17(25)13-22(20)27-24(21)31/h4-9,13-15,21H,3,10-12H2,1-2H3,(H,27,31)(H,28,29)/b26-15+ |
| InChIKey | DARAFTHHWMANDG-CVKSISIWSA-N |
| XLogP | 3.91 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|