C16H11FN4O2 — CID 91485494
5-fluoro-3-[[5-(furan-2-yl)-1H-pyrazol-3-yl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91485494) has the molecular formula C16H11FN4O2 and a molecular weight of 310.29 g/mol. Its IUPAC name is 5-fluoro-3-[[5-(furan-2-yl)-1H-pyrazol-3-yl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-fluoro-3-[[5-(furan-2-yl)-1H-pyrazol-3-yl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91485494 |
| Molecular Formula | C16H11FN4O2 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 5-fluoro-3-[[5-(furan-2-yl)-1H-pyrazol-3-yl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1/C=N/c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C16H11FN4O2/c17-9-3-4-12-10(6-9)11(16(22)19-12)8-18-15-7-13(20-21-15)14-2-1-5-23-14/h1-8,11H,(H,19,22)(H,20,21)/b18-8+ |
| InChIKey | YJJAHHDQMWAIFT-QGMBQPNBSA-N |
| XLogP | 3.25 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|