C22H23FN4O2 — CID 91393535
1-[4-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-2-methylphenyl]piperidine-3-carboxamide (PubChem CID 91393535) has the molecular formula C22H23FN4O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 1-[4-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-2-methylphenyl]piperidine-3-carboxamide.
| Compound Name | 1-[4-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-2-methylphenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 91393535 |
| Molecular Formula | C22H23FN4O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[4-[(5-fluoro-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]-2-methylphenyl]piperidine-3-carboxamide |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3ccc(F)cc32)ccc1N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C22H23FN4O2/c1-13-9-16(5-7-20(13)27-8-2-3-14(12-27)21(24)28)25-11-18-17-10-15(23)4-6-19(17)26-22(18)29/h4-7,9-11,14,18H,2-3,8,12H2,1H3,(H2,24,28)(H,26,29)/b25-11+ |
| InChIKey | HYFVYKIMVPQFGA-OPEKNORGSA-N |
| XLogP | 3.27 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|