C24H29FN4O — CID 90871001
3-[[4-(4-butan-2-ylpiperazin-1-yl)-3-methylphenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one (PubChem CID 90871001) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is 3-[[4-(4-butan-2-ylpiperazin-1-yl)-3-methylphenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-(4-butan-2-ylpiperazin-1-yl)-3-methylphenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90871001 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 3-[[4-(4-butan-2-ylpiperazin-1-yl)-3-methylphenyl]iminomethyl]-4-fluoro-1,3-dihydroindol-2-one |
| SMILES | CCC(C)N1CCN(c2ccc(/N=C/C3C(=O)Nc4cccc(F)c43)cc2C)CC1 |
| InChI | InChI=1S/C24H29FN4O/c1-4-17(3)28-10-12-29(13-11-28)22-9-8-18(14-16(22)2)26-15-19-23-20(25)6-5-7-21(23)27-24(19)30/h5-9,14-15,17,19H,4,10-13H2,1-3H3,(H,27,30)/b26-15+ |
| InChIKey | AOWSYHUDJMAPEO-CVKSISIWSA-N |
| XLogP | 4.49 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|