C21H20FN5O — CID 91555126
4-fluoro-3-[[4-[2-(1H-imidazol-5-yl)ethylamino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91555126) has the molecular formula C21H20FN5O and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-fluoro-3-[[4-[2-(1H-imidazol-5-yl)ethylamino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-fluoro-3-[[4-[2-(1H-imidazol-5-yl)ethylamino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91555126 |
| Molecular Formula | C21H20FN5O |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4-fluoro-3-[[4-[2-(1H-imidazol-5-yl)ethylamino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3cccc(F)c32)ccc1NCCc1cnc[nH]1 |
| InChI | InChI=1S/C21H20FN5O/c1-13-9-14(5-6-18(13)24-8-7-15-10-23-12-26-15)25-11-16-20-17(22)3-2-4-19(20)27-21(16)28/h2-6,9-12,16,24H,7-8H2,1H3,(H,23,26)(H,27,28)/b25-11+ |
| InChIKey | NATJDMGVWLCODS-OPEKNORGSA-N |
| XLogP | 3.95 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|