C24H24N4O — CID 90837777
4-methyl-3-[[3-methyl-4-(2-pyridin-2-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90837777) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-methyl-3-[[3-methyl-4-(2-pyridin-2-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-methyl-3-[[3-methyl-4-(2-pyridin-2-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90837777 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-methyl-3-[[3-methyl-4-(2-pyridin-2-ylethylamino)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3cccc(C)c32)ccc1NCCc1ccccn1 |
| InChI | InChI=1S/C24H24N4O/c1-16-6-5-8-22-23(16)20(24(29)28-22)15-27-19-9-10-21(17(2)14-19)26-13-11-18-7-3-4-12-25-18/h3-10,12,14-15,20,26H,11,13H2,1-2H3,(H,28,29)/b27-15+ |
| InChIKey | KPCTYHAUXBMYDY-JFLMPSFJSA-N |
| XLogP | 4.79 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|