C17H14N4O — CID 91553444
3-(1H-indazol-6-yliminomethyl)-4-methyl-1,3-dihydroindol-2-one (PubChem CID 91553444) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 3-(1H-indazol-6-yliminomethyl)-4-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-(1H-indazol-6-yliminomethyl)-4-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91553444 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 3-(1H-indazol-6-yliminomethyl)-4-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1C(/C=N/c1ccc3cn[nH]c3c1)C(=O)N2 |
| InChI | InChI=1S/C17H14N4O/c1-10-3-2-4-14-16(10)13(17(22)20-14)9-18-12-6-5-11-8-19-21-15(11)7-12/h2-9,13H,1H3,(H,19,21)(H,20,22)/b18-9+ |
| InChIKey | HAJYYNRQVSTFPS-GIJQJNRQSA-N |
| XLogP | 3.31 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|