C16H14N2O2 — CID 90746792
3-[(4-hydroxyphenyl)iminomethyl]-4-methyl-1,3-dihydroindol-2-one (PubChem CID 90746792) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)iminomethyl]-4-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-[(4-hydroxyphenyl)iminomethyl]-4-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90746792 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[(4-hydroxyphenyl)iminomethyl]-4-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1C(/C=N/c1ccc(O)cc1)C(=O)N2 |
| InChI | InChI=1S/C16H14N2O2/c1-10-3-2-4-14-15(10)13(16(20)18-14)9-17-11-5-7-12(19)8-6-11/h2-9,13,19H,1H3,(H,18,20)/b17-9+ |
| InChIKey | CJFXSUKMHFGTFB-RQZCQDPDSA-N |
| XLogP | 3.14 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|