C18H16N2O3 — CID 91536921
2-[4-[(4-methyl-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid (PubChem CID 91536921) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[4-[(4-methyl-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid.
| Compound Name | 2-[4-[(4-methyl-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 91536921 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-[4-[(4-methyl-2-oxo-1,3-dihydroindol-3-yl)methylideneamino]phenyl]acetic acid |
| SMILES | Cc1cccc2c1C(/C=N/c1ccc(CC(=O)O)cc1)C(=O)N2 |
| InChI | InChI=1S/C18H16N2O3/c1-11-3-2-4-15-17(11)14(18(23)20-15)10-19-13-7-5-12(6-8-13)9-16(21)22/h2-8,10,14H,9H2,1H3,(H,20,23)(H,21,22)/b19-10+ |
| InChIKey | JJWBXTBVGRMDRG-VXLYETTFSA-N |
| XLogP | 3.06 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|