C22H19FN4O — CID 90819034
3-[[3-fluoro-4-(pyridin-4-ylmethylamino)phenyl]iminomethyl]-4-methyl-1,3-dihydroindol-2-one (PubChem CID 90819034) has the molecular formula C22H19FN4O and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-[[3-fluoro-4-(pyridin-4-ylmethylamino)phenyl]iminomethyl]-4-methyl-1,3-dihydroindol-2-one.
| Compound Name | 3-[[3-fluoro-4-(pyridin-4-ylmethylamino)phenyl]iminomethyl]-4-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90819034 |
| Molecular Formula | C22H19FN4O |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3-[[3-fluoro-4-(pyridin-4-ylmethylamino)phenyl]iminomethyl]-4-methyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cccc2c1C(/C=N/c1ccc(NCc3ccncc3)c(F)c1)C(=O)N2 |
| InChI | InChI=1S/C22H19FN4O/c1-14-3-2-4-20-21(14)17(22(28)27-20)13-25-16-5-6-19(18(23)11-16)26-12-15-7-9-24-10-8-15/h2-11,13,17,26H,12H2,1H3,(H,27,28)/b25-13+ |
| InChIKey | BWCWWLIHKXSJIK-DHRITJCHSA-N |
| XLogP | 4.58 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|