C22H24FN3O — CID 91600402
4-fluoro-3-[[3-methyl-4-(4-methylpiperidin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91600402) has the molecular formula C22H24FN3O and a molecular weight of 365.45 g/mol. Its IUPAC name is 4-fluoro-3-[[3-methyl-4-(4-methylpiperidin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-fluoro-3-[[3-methyl-4-(4-methylpiperidin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91600402 |
| Molecular Formula | C22H24FN3O |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 4-fluoro-3-[[3-methyl-4-(4-methylpiperidin-1-yl)phenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3cccc(F)c32)ccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C22H24FN3O/c1-14-8-10-26(11-9-14)20-7-6-16(12-15(20)2)24-13-17-21-18(23)4-3-5-19(21)25-22(17)27/h3-7,12-14,17H,8-11H2,1-2H3,(H,25,27)/b24-13+ |
| InChIKey | ZAEHEBULFMJTRN-ZMOGYAJESA-N |
| XLogP | 4.81 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|