C22H26FN3O2 — CID 90750415
4-fluoro-3-[[4-[2-methoxyethyl(propyl)amino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 90750415) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-fluoro-3-[[4-[2-methoxyethyl(propyl)amino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 4-fluoro-3-[[4-[2-methoxyethyl(propyl)amino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90750415 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 4-fluoro-3-[[4-[2-methoxyethyl(propyl)amino]-3-methylphenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | CCCN(CCOC)c1ccc(/N=C/C2C(=O)Nc3cccc(F)c32)cc1C |
| InChI | InChI=1S/C22H26FN3O2/c1-4-10-26(11-12-28-3)20-9-8-16(13-15(20)2)24-14-17-21-18(23)6-5-7-19(21)25-22(17)27/h5-9,13-14,17H,4,10-12H2,1-3H3,(H,25,27)/b24-14+ |
| InChIKey | CVCMUBULJVBLHA-ZVHZXABRSA-N |
| XLogP | 4.44 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|