C22H24FN3O3 — CID 90718823
3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]-3-methylphenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one (PubChem CID 90718823) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is 3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]-3-methylphenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]-3-methylphenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 90718823 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[[4-[2-(1,3-dioxolan-2-yl)ethyl-methylamino]-3-methylphenyl]iminomethyl]-6-fluoro-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(/N=C/C2C(=O)Nc3cc(F)ccc32)ccc1N(C)CCC1OCCO1 |
| InChI | InChI=1S/C22H24FN3O3/c1-14-11-16(4-6-20(14)26(2)8-7-21-28-9-10-29-21)24-13-18-17-5-3-15(23)12-19(17)25-22(18)27/h3-6,11-13,18,21H,7-10H2,1-2H3,(H,25,27)/b24-13+ |
| InChIKey | OWQVGYLPTCLYFF-ZMOGYAJESA-N |
| XLogP | 3.77 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|